About N'-(furan-2-ylmethyl)-N,N-dimethyl-N'-[(1-methylpyrazol-4-yl)methyl]propane-1,3-diamine
N'-(furan-2-ylmethyl)-N,N-dimethyl-N'-[(1-methylpyrazol-4-yl)methyl]propane-1,3-diamine (PubChem CID 46954431) has the molecular formula C15H24N4O
and a molecular weight of 276.38 g/mol. Its IUPAC name is N'-(furan-2-ylmethyl)-N,N-dimethyl-N'-[(1-methylpyrazol-4-yl)methyl]propane-1,3-diamine.
Molecular Properties
| Compound Name | N'-(furan-2-ylmethyl)-N,N-dimethyl-N'-[(1-methylpyrazol-4-yl)methyl]propane-1,3-diamine |
| PubChem CID | 46954431 |
| Molecular Formula | C15H24N4O |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | N'-(furan-2-ylmethyl)-N,N-dimethyl-N'-[(1-methylpyrazol-4-yl)methyl]propane-1,3-diamine |
| SMILES | CN(C)CCCN(Cc1cnn(C)c1)Cc1ccco1 |
| InChI | InChI=1S/C15H24N4O/c1-17(2)7-5-8-19(13-15-6-4-9-20-15)12-14-10-16-18(3)11-14/h4,6,9-11H,5,7-8,12-13H2,1-3H3 |
| InChIKey | UWSTZRHZWFOJRW-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 37.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N'-(furan-2-ylmethyl)-N,N-dimethyl-N'-[(1-methylpyrazol-4-yl)methyl]propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(furan-2-ylmethyl)-N,N-dimethyl-N'-[(1-methylpyrazol-4-yl)methyl]propane-1,3-diamine?
The IUPAC name of N'-(furan-2-ylmethyl)-N,N-dimethyl-N'-[(1-methylpyrazol-4-yl)methyl]propane-1,3-diamine (CID 46954431) is N'-(furan-2-ylmethyl)-N,N-dimethyl-N'-[(1-methylpyrazol-4-yl)methyl]propane-1,3-diamine.
What is the SMILES notation for N'-(furan-2-ylmethyl)-N,N-dimethyl-N'-[(1-methylpyrazol-4-yl)methyl]propane-1,3-diamine?
The canonical SMILES for N'-(furan-2-ylmethyl)-N,N-dimethyl-N'-[(1-methylpyrazol-4-yl)methyl]propane-1,3-diamine is CN(C)CCCN(Cc1cnn(C)c1)Cc1ccco1.
What is the InChIKey of N'-(furan-2-ylmethyl)-N,N-dimethyl-N'-[(1-methylpyrazol-4-yl)methyl]propane-1,3-diamine?
The InChIKey is UWSTZRHZWFOJRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N4O/c1-17(2)7-5-8-19(13-15-6-4-9-20-15)12-14-10-16-18(3)11-14/h4,6,9-11H,5,7-8,12-13H2,1-3H3.
What are the key properties of N'-(furan-2-ylmethyl)-N,N-dimethyl-N'-[(1-methylpyrazol-4-yl)methyl]propane-1,3-diamine?
N'-(furan-2-ylmethyl)-N,N-dimethyl-N'-[(1-methylpyrazol-4-yl)methyl]propane-1,3-diamine has a molecular weight of 276.38 g/mol, XLogP of 1.97, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(furan-2-ylmethyl)-N,N-dimethyl-N'-[(1-methylpyrazol-4-yl)methyl]propane-1,3-diamine is sourced from PubChem (CID 46954431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).