About 2-(5,6-dimethyl-1-benzofuran-3-yl)-N-methyl-N-(1-propan-2-ylpiperidin-4-yl)acetamide
2-(5,6-dimethyl-1-benzofuran-3-yl)-N-methyl-N-(1-propan-2-ylpiperidin-4-yl)acetamide (PubChem CID 46954636) has the molecular formula C21H30N2O2
and a molecular weight of 342.48 g/mol. Its IUPAC name is 2-(5,6-dimethyl-1-benzofuran-3-yl)-N-methyl-N-(1-propan-2-ylpiperidin-4-yl)acetamide.
Molecular Properties
| Compound Name | 2-(5,6-dimethyl-1-benzofuran-3-yl)-N-methyl-N-(1-propan-2-ylpiperidin-4-yl)acetamide |
| PubChem CID | 46954636 |
| Molecular Formula | C21H30N2O2 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | 2-(5,6-dimethyl-1-benzofuran-3-yl)-N-methyl-N-(1-propan-2-ylpiperidin-4-yl)acetamide |
| SMILES | Cc1cc2occ(CC(=O)N(C)C3CCN(C(C)C)CC3)c2cc1C |
| InChI | InChI=1S/C21H30N2O2/c1-14(2)23-8-6-18(7-9-23)22(5)21(24)12-17-13-25-20-11-16(4)15(3)10-19(17)20/h10-11,13-14,18H,6-9,12H2,1-5H3 |
| InChIKey | NUSIJTXGZXIELN-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 36.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(5,6-dimethyl-1-benzofuran-3-yl)-N-methyl-N-(1-propan-2-ylpiperidin-4-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5,6-dimethyl-1-benzofuran-3-yl)-N-methyl-N-(1-propan-2-ylpiperidin-4-yl)acetamide?
The IUPAC name of 2-(5,6-dimethyl-1-benzofuran-3-yl)-N-methyl-N-(1-propan-2-ylpiperidin-4-yl)acetamide (CID 46954636) is 2-(5,6-dimethyl-1-benzofuran-3-yl)-N-methyl-N-(1-propan-2-ylpiperidin-4-yl)acetamide.
What is the SMILES notation for 2-(5,6-dimethyl-1-benzofuran-3-yl)-N-methyl-N-(1-propan-2-ylpiperidin-4-yl)acetamide?
The canonical SMILES for 2-(5,6-dimethyl-1-benzofuran-3-yl)-N-methyl-N-(1-propan-2-ylpiperidin-4-yl)acetamide is Cc1cc2occ(CC(=O)N(C)C3CCN(C(C)C)CC3)c2cc1C.
What is the InChIKey of 2-(5,6-dimethyl-1-benzofuran-3-yl)-N-methyl-N-(1-propan-2-ylpiperidin-4-yl)acetamide?
The InChIKey is NUSIJTXGZXIELN-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H30N2O2/c1-14(2)23-8-6-18(7-9-23)22(5)21(24)12-17-13-25-20-11-16(4)15(3)10-19(17)20/h10-11,13-14,18H,6-9,12H2,1-5H3.
What are the key properties of 2-(5,6-dimethyl-1-benzofuran-3-yl)-N-methyl-N-(1-propan-2-ylpiperidin-4-yl)acetamide?
2-(5,6-dimethyl-1-benzofuran-3-yl)-N-methyl-N-(1-propan-2-ylpiperidin-4-yl)acetamide has a molecular weight of 342.48 g/mol, XLogP of 3.92, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5,6-dimethyl-1-benzofuran-3-yl)-N-methyl-N-(1-propan-2-ylpiperidin-4-yl)acetamide is sourced from PubChem (CID 46954636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).