C25H29ClN2O3 — CID 46955178
6-chloro-1'-[2-hydroxy-2-(2-methyl-1H-indol-3-yl)ethyl]-7-methylspiro[3,4-dihydrochromene-2,4'-piperidine]-4-ol (PubChem CID 46955178) has the molecular formula C25H29ClN2O3 and a molecular weight of 440.97 g/mol. Its IUPAC name is 6-chloro-1'-[2-hydroxy-2-(2-methyl-1H-indol-3-yl)ethyl]-7-methylspiro[3,4-dihydrochromene-2,4'-piperidine]-4-ol.
| Compound Name | 6-chloro-1'-[2-hydroxy-2-(2-methyl-1H-indol-3-yl)ethyl]-7-methylspiro[3,4-dihydrochromene-2,4'-piperidine]-4-ol |
|---|---|
| PubChem CID | 46955178 |
| Molecular Formula | C25H29ClN2O3 |
| Molecular Weight | 440.97 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | 6-chloro-1'-[2-hydroxy-2-(2-methyl-1H-indol-3-yl)ethyl]-7-methylspiro[3,4-dihydrochromene-2,4'-piperidine]-4-ol |
| SMILES | Cc1cc2c(cc1Cl)C(O)CC1(CCN(CC(O)c3c(C)[nH]c4ccccc34)CC1)O2 |
| InChI | InChI=1S/C25H29ClN2O3/c1-15-11-23-18(12-19(15)26)21(29)13-25(31-23)7-9-28(10-8-25)14-22(30)24-16(2)27-20-6-4-3-5-17(20)24/h3-6,11-12,21-22,27,29-30H,7-10,13-14H2,1-2H3 |
| InChIKey | WSJFAQGUISZBKH-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 68.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.97 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|