C19H19N5 — CID 46955768
N-(pyridin-3-ylmethyl)-N-[(2-pyridin-3-ylpyrimidin-4-yl)methyl]cyclopropanamine (PubChem CID 46955768) has the molecular formula C19H19N5 and a molecular weight of 317.40 g/mol. Its IUPAC name is N-(pyridin-3-ylmethyl)-N-[(2-pyridin-3-ylpyrimidin-4-yl)methyl]cyclopropanamine.
| Compound Name | N-(pyridin-3-ylmethyl)-N-[(2-pyridin-3-ylpyrimidin-4-yl)methyl]cyclopropanamine |
|---|---|
| PubChem CID | 46955768 |
| Molecular Formula | C19H19N5 |
| Molecular Weight | 317.40 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | N-(pyridin-3-ylmethyl)-N-[(2-pyridin-3-ylpyrimidin-4-yl)methyl]cyclopropanamine |
| SMILES | c1cncc(CN(Cc2ccnc(-c3cccnc3)n2)C2CC2)c1 |
| InChI | InChI=1S/C19H19N5/c1-3-15(11-20-8-1)13-24(18-5-6-18)14-17-7-10-22-19(23-17)16-4-2-9-21-12-16/h1-4,7-12,18H,5-6,13-14H2 |
| InChIKey | DMVIEYZWSDUMHY-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 54.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.40 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |