C15H16FNOS — CID 46956016
(3S,4S)-4-(4-fluorophenyl)-N-(thiophen-3-ylmethyl)oxolan-3-amine (PubChem CID 46956016) has the molecular formula C15H16FNOS and a molecular weight of 277.36 g/mol. Its IUPAC name is (3S,4S)-4-(4-fluorophenyl)-N-(thiophen-3-ylmethyl)oxolan-3-amine.
| Compound Name | (3S,4S)-4-(4-fluorophenyl)-N-(thiophen-3-ylmethyl)oxolan-3-amine |
|---|---|
| PubChem CID | 46956016 |
| Molecular Formula | C15H16FNOS |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | (3S,4S)-4-(4-fluorophenyl)-N-(thiophen-3-ylmethyl)oxolan-3-amine |
| SMILES | Fc1ccc([C@@H]2COC[C@H]2NCc2ccsc2)cc1 |
| InChI | InChI=1S/C15H16FNOS/c16-13-3-1-12(2-4-13)14-8-18-9-15(14)17-7-11-5-6-19-10-11/h1-6,10,14-15,17H,7-9H2/t14-,15+/m0/s1 |
| InChIKey | MTZYPSUGJZFYHT-LSDHHAIUSA-N |
| XLogP | 3.16 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |