C23H28N2O2 — CID 46956299
(1R,3R)-1-cyclohex-3-en-1-yl-6,7-dimethoxy-3-(5-methyl-2-pyridinyl)-1,2,3,4-tetrahydroisoquinoline (PubChem CID 46956299) has the molecular formula C23H28N2O2 and a molecular weight of 364.49 g/mol. Its IUPAC name is (1R,3R)-1-cyclohex-3-en-1-yl-6,7-dimethoxy-3-(5-methyl-2-pyridinyl)-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | (1R,3R)-1-cyclohex-3-en-1-yl-6,7-dimethoxy-3-(5-methyl-2-pyridinyl)-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 46956299 |
| Molecular Formula | C23H28N2O2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | (1R,3R)-1-cyclohex-3-en-1-yl-6,7-dimethoxy-3-(5-methyl-2-pyridinyl)-1,2,3,4-tetrahydroisoquinoline |
| SMILES | COc1cc2c(cc1OC)[C@@H](C1CC=CCC1)N[C@@H](c1ccc(C)cn1)C2 |
| InChI | InChI=1S/C23H28N2O2/c1-15-9-10-19(24-14-15)20-11-17-12-21(26-2)22(27-3)13-18(17)23(25-20)16-7-5-4-6-8-16/h4-5,9-10,12-14,16,20,23,25H,6-8,11H2,1-3H3/t16?,20-,23-/m1/s1 |
| InChIKey | KCOOJXQVUATHNA-JRAJRYKFSA-N |
| XLogP | 4.69 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|