C25H25FN2O3 — CID 46956503
1-[(4aS,7aS)-6-(3-methyl-1-benzofuran-2-carbonyl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl]-2-(4-fluorophenyl)ethanone (PubChem CID 46956503) has the molecular formula C25H25FN2O3 and a molecular weight of 420.48 g/mol. Its IUPAC name is 1-[(4aS,7aS)-6-(3-methyl-1-benzofuran-2-carbonyl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl]-2-(4-fluorophenyl)ethanone.
| Compound Name | 1-[(4aS,7aS)-6-(3-methyl-1-benzofuran-2-carbonyl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl]-2-(4-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 46956503 |
| Molecular Formula | C25H25FN2O3 |
| Molecular Weight | 420.48 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | 1-[(4aS,7aS)-6-(3-methyl-1-benzofuran-2-carbonyl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl]-2-(4-fluorophenyl)ethanone |
| SMILES | Cc1c(C(=O)N2C[C@@H]3CCCN(C(=O)Cc4ccc(F)cc4)[C@@H]3C2)oc2ccccc12 |
| InChI | InChI=1S/C25H25FN2O3/c1-16-20-6-2-3-7-22(20)31-24(16)25(30)27-14-18-5-4-12-28(21(18)15-27)23(29)13-17-8-10-19(26)11-9-17/h2-3,6-11,18,21H,4-5,12-15H2,1H3/t18-,21+/m0/s1 |
| InChIKey | XYUUEVOCUPWQSD-GHTZIAJQSA-N |
| XLogP | 4.19 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.48 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |