About 3,4-dibromo-2-[(2,5-dimethoxyphenyl)iminomethyl]-6-methoxyphenol
3,4-dibromo-2-[(2,5-dimethoxyphenyl)iminomethyl]-6-methoxyphenol (PubChem CID 4695693) has the molecular formula C16H15Br2NO4
and a molecular weight of 445.11 g/mol. Its IUPAC name is 3,4-dibromo-2-[(2,5-dimethoxyphenyl)iminomethyl]-6-methoxyphenol.
Molecular Properties
| Compound Name | 3,4-dibromo-2-[(2,5-dimethoxyphenyl)iminomethyl]-6-methoxyphenol |
| PubChem CID | 4695693 |
| Molecular Formula | C16H15Br2NO4 |
| Molecular Weight | 445.11 g/mol |
| Exact Mass | 442.94 |
| IUPAC Name | 3,4-dibromo-2-[(2,5-dimethoxyphenyl)iminomethyl]-6-methoxyphenol |
| SMILES | COc1ccc(OC)c(/N=C/c2c(O)c(OC)cc(Br)c2Br)c1 |
| InChI | InChI=1S/C16H15Br2NO4/c1-21-9-4-5-13(22-2)12(6-9)19-8-10-15(18)11(17)7-14(23-3)16(10)20/h4-8,20H,1-3H3/b19-8+ |
| InChIKey | NVDIJHILBKFJOG-UFWORHAWSA-N |
| XLogP | 4.69 |
| TPSA | 60.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 445.11 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dibromo-2-[(2,5-dimethoxyphenyl)iminomethyl]-6-methoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dibromo-2-[(2,5-dimethoxyphenyl)iminomethyl]-6-methoxyphenol?
The IUPAC name of 3,4-dibromo-2-[(2,5-dimethoxyphenyl)iminomethyl]-6-methoxyphenol (CID 4695693) is 3,4-dibromo-2-[(2,5-dimethoxyphenyl)iminomethyl]-6-methoxyphenol.
What is the SMILES notation for 3,4-dibromo-2-[(2,5-dimethoxyphenyl)iminomethyl]-6-methoxyphenol?
The canonical SMILES for 3,4-dibromo-2-[(2,5-dimethoxyphenyl)iminomethyl]-6-methoxyphenol is COc1ccc(OC)c(/N=C/c2c(O)c(OC)cc(Br)c2Br)c1.
What is the InChIKey of 3,4-dibromo-2-[(2,5-dimethoxyphenyl)iminomethyl]-6-methoxyphenol?
The InChIKey is NVDIJHILBKFJOG-UFWORHAWSA-N. The full InChI is InChI=1S/C16H15Br2NO4/c1-21-9-4-5-13(22-2)12(6-9)19-8-10-15(18)11(17)7-14(23-3)16(10)20/h4-8,20H,1-3H3/b19-8+.
What are the key properties of 3,4-dibromo-2-[(2,5-dimethoxyphenyl)iminomethyl]-6-methoxyphenol?
3,4-dibromo-2-[(2,5-dimethoxyphenyl)iminomethyl]-6-methoxyphenol has a molecular weight of 445.11 g/mol, XLogP of 4.69, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dibromo-2-[(2,5-dimethoxyphenyl)iminomethyl]-6-methoxyphenol is sourced from PubChem (CID 4695693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).