C31H36N4O6 — CID 4695749
5-(3-ethoxy-4-prop-2-enoxyphenyl)-4-[hydroxy-(2-methylimidazo[1,2-a]pyridin-3-yl)methylidene]-1-(3-morpholin-4-ylpropyl)pyrrolidine-2,3-dione (PubChem CID 4695749) has the molecular formula C31H36N4O6 and a molecular weight of 560.65 g/mol. Its IUPAC name is 5-(3-ethoxy-4-prop-2-enoxyphenyl)-4-[hydroxy-(2-methylimidazo[1,2-a]pyridin-3-yl)methylidene]-1-(3-morpholin-4-ylpropyl)pyrrolidine-2,3-dione.
| Compound Name | 5-(3-ethoxy-4-prop-2-enoxyphenyl)-4-[hydroxy-(2-methylimidazo[1,2-a]pyridin-3-yl)methylidene]-1-(3-morpholin-4-ylpropyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 4695749 |
| Molecular Formula | C31H36N4O6 |
| Molecular Weight | 560.65 g/mol |
| Exact Mass | 560.26 |
| IUPAC Name | 5-(3-ethoxy-4-prop-2-enoxyphenyl)-4-[hydroxy-(2-methylimidazo[1,2-a]pyridin-3-yl)methylidene]-1-(3-morpholin-4-ylpropyl)pyrrolidine-2,3-dione |
| SMILES | C=CCOc1ccc(C2C(=C(O)c3c(C)nc4ccccn34)C(=O)C(=O)N2CCCN2CCOCC2)cc1OCC |
| InChI | InChI=1S/C31H36N4O6/c1-4-17-41-23-11-10-22(20-24(23)40-5-2)28-26(29(36)27-21(3)32-25-9-6-7-13-34(25)27)30(37)31(38)35(28)14-8-12-33-15-18-39-19-16-33/h4,6-7,9-11,13,20,28,36H,1,5,8,12,14-19H2,2-3H3 |
| InChIKey | CRANFXBKJQFSQJ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.65 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|