About N-[[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]methyl]pyrazine-2-carboxamide
N-[[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]methyl]pyrazine-2-carboxamide (PubChem CID 46958800) has the molecular formula C17H22N6O
and a molecular weight of 326.40 g/mol. Its IUPAC name is N-[[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]methyl]pyrazine-2-carboxamide.
Molecular Properties
| Compound Name | N-[[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]methyl]pyrazine-2-carboxamide |
| PubChem CID | 46958800 |
| Molecular Formula | C17H22N6O |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | N-[[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]methyl]pyrazine-2-carboxamide |
| SMILES | Cc1cc(C)nc(N2CCC(CNC(=O)c3cnccn3)CC2)n1 |
| InChI | InChI=1S/C17H22N6O/c1-12-9-13(2)22-17(21-12)23-7-3-14(4-8-23)10-20-16(24)15-11-18-5-6-19-15/h5-6,9,11,14H,3-4,7-8,10H2,1-2H3,(H,20,24) |
| InChIKey | DSDDQINJDPXEKR-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 83.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]methyl]pyrazine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]methyl]pyrazine-2-carboxamide?
The IUPAC name of N-[[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]methyl]pyrazine-2-carboxamide (CID 46958800) is N-[[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]methyl]pyrazine-2-carboxamide.
What is the SMILES notation for N-[[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]methyl]pyrazine-2-carboxamide?
The canonical SMILES for N-[[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]methyl]pyrazine-2-carboxamide is Cc1cc(C)nc(N2CCC(CNC(=O)c3cnccn3)CC2)n1.
What is the InChIKey of N-[[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]methyl]pyrazine-2-carboxamide?
The InChIKey is DSDDQINJDPXEKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N6O/c1-12-9-13(2)22-17(21-12)23-7-3-14(4-8-23)10-20-16(24)15-11-18-5-6-19-15/h5-6,9,11,14H,3-4,7-8,10H2,1-2H3,(H,20,24).
What are the key properties of N-[[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]methyl]pyrazine-2-carboxamide?
N-[[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]methyl]pyrazine-2-carboxamide has a molecular weight of 326.40 g/mol, XLogP of 1.53, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]methyl]pyrazine-2-carboxamide is sourced from PubChem (CID 46958800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).