C20H22N4O4 — CID 46959160
2-(4,7-dimethyl-9-oxo-3-oxa-7,10,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-10-yl)-N-[4-(furan-2-yl)butan-2-yl]acetamide (PubChem CID 46959160) has the molecular formula C20H22N4O4 and a molecular weight of 382.42 g/mol. Its IUPAC name is 2-(4,7-dimethyl-9-oxo-3-oxa-7,10,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-10-yl)-N-[4-(furan-2-yl)butan-2-yl]acetamide.
| Compound Name | 2-(4,7-dimethyl-9-oxo-3-oxa-7,10,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-10-yl)-N-[4-(furan-2-yl)butan-2-yl]acetamide |
|---|---|
| PubChem CID | 46959160 |
| Molecular Formula | C20H22N4O4 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 2-(4,7-dimethyl-9-oxo-3-oxa-7,10,11-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,11-tetraen-10-yl)-N-[4-(furan-2-yl)butan-2-yl]acetamide |
| SMILES | Cc1cc2c(o1)c1cnn(CC(=O)NC(C)CCc3ccco3)c(=O)c1n2C |
| InChI | InChI=1S/C20H22N4O4/c1-12(6-7-14-5-4-8-27-14)22-17(25)11-24-20(26)18-15(10-21-24)19-16(23(18)3)9-13(2)28-19/h4-5,8-10,12H,6-7,11H2,1-3H3,(H,22,25) |
| InChIKey | GGLUCUNGRCQYHX-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 95.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |