C18H19FN4O2 — CID 46959425
N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-5-(4-fluorophenyl)-1,3-oxazole-4-carboxamide (PubChem CID 46959425) has the molecular formula C18H19FN4O2 and a molecular weight of 342.37 g/mol. Its IUPAC name is N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-5-(4-fluorophenyl)-1,3-oxazole-4-carboxamide.
| Compound Name | N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-5-(4-fluorophenyl)-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 46959425 |
| Molecular Formula | C18H19FN4O2 |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-5-(4-fluorophenyl)-1,3-oxazole-4-carboxamide |
| SMILES | Cc1cc(C)n(CCCNC(=O)c2ncoc2-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C18H19FN4O2/c1-12-10-13(2)23(22-12)9-3-8-20-18(24)16-17(25-11-21-16)14-4-6-15(19)7-5-14/h4-7,10-11H,3,8-9H2,1-2H3,(H,20,24) |
| InChIKey | ZMEKAQVBCHWGCI-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 72.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|