C20H25Cl2N3O — CID 46960337
(3R,7R)-2-[[1-[(3,4-dichlorophenyl)methyl]pyrrol-2-yl]methyl]-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-ol (PubChem CID 46960337) has the molecular formula C20H25Cl2N3O and a molecular weight of 394.35 g/mol. Its IUPAC name is (3R,7R)-2-[[1-[(3,4-dichlorophenyl)methyl]pyrrol-2-yl]methyl]-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-ol.
| Compound Name | (3R,7R)-2-[[1-[(3,4-dichlorophenyl)methyl]pyrrol-2-yl]methyl]-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-ol |
|---|---|
| PubChem CID | 46960337 |
| Molecular Formula | C20H25Cl2N3O |
| Molecular Weight | 394.35 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | (3R,7R)-2-[[1-[(3,4-dichlorophenyl)methyl]pyrrol-2-yl]methyl]-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-ol |
| SMILES | C[C@@H]1CN2C[C@H](O)CC2CN1Cc1cccn1Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H25Cl2N3O/c1-14-9-25-13-18(26)8-17(25)12-24(14)11-16-3-2-6-23(16)10-15-4-5-19(21)20(22)7-15/h2-7,14,17-18,26H,8-13H2,1H3/t14-,17?,18-/m1/s1 |
| InChIKey | WZKVUBPBNVLPFC-FHKHCFAMSA-N |
| XLogP | 3.48 |
| TPSA | 31.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.35 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |