About 1-[5-(3-methyl-1,2-oxazol-5-yl)-4-[(2R)-oxolan-2-yl]pyrimidin-2-yl]piperidin-3-ol
1-[5-(3-methyl-1,2-oxazol-5-yl)-4-[(2R)-oxolan-2-yl]pyrimidin-2-yl]piperidin-3-ol (PubChem CID 46960986) has the molecular formula C17H22N4O3
and a molecular weight of 330.39 g/mol. Its IUPAC name is 1-[5-(3-methyl-1,2-oxazol-5-yl)-4-[(2R)-oxolan-2-yl]pyrimidin-2-yl]piperidin-3-ol.
Molecular Properties
| Compound Name | 1-[5-(3-methyl-1,2-oxazol-5-yl)-4-[(2R)-oxolan-2-yl]pyrimidin-2-yl]piperidin-3-ol |
| PubChem CID | 46960986 |
| Molecular Formula | C17H22N4O3 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | 1-[5-(3-methyl-1,2-oxazol-5-yl)-4-[(2R)-oxolan-2-yl]pyrimidin-2-yl]piperidin-3-ol |
| SMILES | Cc1cc(-c2cnc(N3CCCC(O)C3)nc2[C@H]2CCCO2)on1 |
| InChI | InChI=1S/C17H22N4O3/c1-11-8-15(24-20-11)13-9-18-17(21-6-2-4-12(22)10-21)19-16(13)14-5-3-7-23-14/h8-9,12,14,22H,2-7,10H2,1H3/t12?,14-/m1/s1 |
| InChIKey | ZMTJOFJMUYDZFZ-TYZXPVIJSA-N |
| XLogP | 2.25 |
| TPSA | 84.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-[5-(3-methyl-1,2-oxazol-5-yl)-4-[(2R)-oxolan-2-yl]pyrimidin-2-yl]piperidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-(3-methyl-1,2-oxazol-5-yl)-4-[(2R)-oxolan-2-yl]pyrimidin-2-yl]piperidin-3-ol?
The IUPAC name of 1-[5-(3-methyl-1,2-oxazol-5-yl)-4-[(2R)-oxolan-2-yl]pyrimidin-2-yl]piperidin-3-ol (CID 46960986) is 1-[5-(3-methyl-1,2-oxazol-5-yl)-4-[(2R)-oxolan-2-yl]pyrimidin-2-yl]piperidin-3-ol.
What is the SMILES notation for 1-[5-(3-methyl-1,2-oxazol-5-yl)-4-[(2R)-oxolan-2-yl]pyrimidin-2-yl]piperidin-3-ol?
The canonical SMILES for 1-[5-(3-methyl-1,2-oxazol-5-yl)-4-[(2R)-oxolan-2-yl]pyrimidin-2-yl]piperidin-3-ol is Cc1cc(-c2cnc(N3CCCC(O)C3)nc2[C@H]2CCCO2)on1.
What is the InChIKey of 1-[5-(3-methyl-1,2-oxazol-5-yl)-4-[(2R)-oxolan-2-yl]pyrimidin-2-yl]piperidin-3-ol?
The InChIKey is ZMTJOFJMUYDZFZ-TYZXPVIJSA-N. The full InChI is InChI=1S/C17H22N4O3/c1-11-8-15(24-20-11)13-9-18-17(21-6-2-4-12(22)10-21)19-16(13)14-5-3-7-23-14/h8-9,12,14,22H,2-7,10H2,1H3/t12?,14-/m1/s1.
What are the key properties of 1-[5-(3-methyl-1,2-oxazol-5-yl)-4-[(2R)-oxolan-2-yl]pyrimidin-2-yl]piperidin-3-ol?
1-[5-(3-methyl-1,2-oxazol-5-yl)-4-[(2R)-oxolan-2-yl]pyrimidin-2-yl]piperidin-3-ol has a molecular weight of 330.39 g/mol, XLogP of 2.25, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-(3-methyl-1,2-oxazol-5-yl)-4-[(2R)-oxolan-2-yl]pyrimidin-2-yl]piperidin-3-ol is sourced from PubChem (CID 46960986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).