C20H26FN3O — CID 46961120
2-[(1,3-dimethylpyrazol-4-yl)methyl]-4-(3-fluorophenyl)-3,3a,5,6,7,7a-hexahydro-1H-isoindol-4-ol (PubChem CID 46961120) has the molecular formula C20H26FN3O and a molecular weight of 343.45 g/mol. Its IUPAC name is 2-[(1,3-dimethylpyrazol-4-yl)methyl]-4-(3-fluorophenyl)-3,3a,5,6,7,7a-hexahydro-1H-isoindol-4-ol.
| Compound Name | 2-[(1,3-dimethylpyrazol-4-yl)methyl]-4-(3-fluorophenyl)-3,3a,5,6,7,7a-hexahydro-1H-isoindol-4-ol |
|---|---|
| PubChem CID | 46961120 |
| Molecular Formula | C20H26FN3O |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | 2-[(1,3-dimethylpyrazol-4-yl)methyl]-4-(3-fluorophenyl)-3,3a,5,6,7,7a-hexahydro-1H-isoindol-4-ol |
| SMILES | Cc1nn(C)cc1CN1CC2CCCC(O)(c3cccc(F)c3)C2C1 |
| InChI | InChI=1S/C20H26FN3O/c1-14-16(10-23(2)22-14)12-24-11-15-5-4-8-20(25,19(15)13-24)17-6-3-7-18(21)9-17/h3,6-7,9-10,15,19,25H,4-5,8,11-13H2,1-2H3 |
| InChIKey | MTPKGDWXUYCGBJ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |