C22H30FN3O — CID 46961121
4-(3-fluorophenyl)-2-[(5-methyl-1-propylpyrazol-4-yl)methyl]-3,3a,5,6,7,7a-hexahydro-1H-isoindol-4-ol (PubChem CID 46961121) has the molecular formula C22H30FN3O and a molecular weight of 371.50 g/mol. Its IUPAC name is 4-(3-fluorophenyl)-2-[(5-methyl-1-propylpyrazol-4-yl)methyl]-3,3a,5,6,7,7a-hexahydro-1H-isoindol-4-ol.
| Compound Name | 4-(3-fluorophenyl)-2-[(5-methyl-1-propylpyrazol-4-yl)methyl]-3,3a,5,6,7,7a-hexahydro-1H-isoindol-4-ol |
|---|---|
| PubChem CID | 46961121 |
| Molecular Formula | C22H30FN3O |
| Molecular Weight | 371.50 g/mol |
| Exact Mass | 371.24 |
| IUPAC Name | 4-(3-fluorophenyl)-2-[(5-methyl-1-propylpyrazol-4-yl)methyl]-3,3a,5,6,7,7a-hexahydro-1H-isoindol-4-ol |
| SMILES | CCCn1ncc(CN2CC3CCCC(O)(c4cccc(F)c4)C3C2)c1C |
| InChI | InChI=1S/C22H30FN3O/c1-3-10-26-16(2)18(12-24-26)14-25-13-17-6-5-9-22(27,21(17)15-25)19-7-4-8-20(23)11-19/h4,7-8,11-12,17,21,27H,3,5-6,9-10,13-15H2,1-2H3 |
| InChIKey | DPVHVEQGWXSMLA-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.50 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |