C22H32N6O — CID 46961271
1-[12-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-5-yl]piperidin-3-ol (PubChem CID 46961271) has the molecular formula C22H32N6O and a molecular weight of 396.54 g/mol. Its IUPAC name is 1-[12-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-5-yl]piperidin-3-ol.
| Compound Name | 1-[12-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-5-yl]piperidin-3-ol |
|---|---|
| PubChem CID | 46961271 |
| Molecular Formula | C22H32N6O |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.26 |
| IUPAC Name | 1-[12-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-5-yl]piperidin-3-ol |
| SMILES | CCn1nc(C)c(CN2C3CCC2c2cnc(N4CCCC(O)C4)nc2C3)c1C |
| InChI | InChI=1S/C22H32N6O/c1-4-28-15(3)19(14(2)25-28)13-27-16-7-8-21(27)18-11-23-22(24-20(18)10-16)26-9-5-6-17(29)12-26/h11,16-17,21,29H,4-10,12-13H2,1-3H3 |
| InChIKey | MCJQOELCHDFNBS-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |