C17H19N5O2S — CID 46961279
(5-morpholin-4-yl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl)-(1,3-thiazol-4-yl)methanone (PubChem CID 46961279) has the molecular formula C17H19N5O2S and a molecular weight of 357.44 g/mol. Its IUPAC name is (5-morpholin-4-yl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl)-(1,3-thiazol-4-yl)methanone.
| Compound Name | (5-morpholin-4-yl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl)-(1,3-thiazol-4-yl)methanone |
|---|---|
| PubChem CID | 46961279 |
| Molecular Formula | C17H19N5O2S |
| Molecular Weight | 357.44 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | (5-morpholin-4-yl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl)-(1,3-thiazol-4-yl)methanone |
| SMILES | O=C(c1cscn1)N1C2CCC1c1cnc(N3CCOCC3)nc1C2 |
| InChI | InChI=1S/C17H19N5O2S/c23-16(14-9-25-10-19-14)22-11-1-2-15(22)12-8-18-17(20-13(12)7-11)21-3-5-24-6-4-21/h8-11,15H,1-7H2 |
| InChIKey | VICKPGIQKNCSKH-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 71.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.44 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |