C14H17NO2S2 — CID 46961399
2-(furan-2-ylmethylsulfanyl)-N-(1-thiophen-2-ylpropan-2-yl)acetamide (PubChem CID 46961399) has the molecular formula C14H17NO2S2 and a molecular weight of 295.43 g/mol. Its IUPAC name is 2-(furan-2-ylmethylsulfanyl)-N-(1-thiophen-2-ylpropan-2-yl)acetamide.
| Compound Name | 2-(furan-2-ylmethylsulfanyl)-N-(1-thiophen-2-ylpropan-2-yl)acetamide |
|---|---|
| PubChem CID | 46961399 |
| Molecular Formula | C14H17NO2S2 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | 2-(furan-2-ylmethylsulfanyl)-N-(1-thiophen-2-ylpropan-2-yl)acetamide |
| SMILES | CC(Cc1cccs1)NC(=O)CSCc1ccco1 |
| InChI | InChI=1S/C14H17NO2S2/c1-11(8-13-5-3-7-19-13)15-14(16)10-18-9-12-4-2-6-17-12/h2-7,11H,8-10H2,1H3,(H,15,16) |
| InChIKey | QCCCYFORCKNNMV-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |