C22H19N5O2 — CID 46962800
6-methyl-4-phenyl-11-(2-pyridin-4-ylethyl)-13-oxa-2,4,5,11-tetrazatricyclo[7.4.0.03,7]trideca-1,3(7),5,8-tetraen-12-one (PubChem CID 46962800) has the molecular formula C22H19N5O2 and a molecular weight of 385.43 g/mol. Its IUPAC name is 6-methyl-4-phenyl-11-(2-pyridin-4-ylethyl)-13-oxa-2,4,5,11-tetrazatricyclo[7.4.0.03,7]trideca-1,3(7),5,8-tetraen-12-one.
| Compound Name | 6-methyl-4-phenyl-11-(2-pyridin-4-ylethyl)-13-oxa-2,4,5,11-tetrazatricyclo[7.4.0.03,7]trideca-1,3(7),5,8-tetraen-12-one |
|---|---|
| PubChem CID | 46962800 |
| Molecular Formula | C22H19N5O2 |
| Molecular Weight | 385.43 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | 6-methyl-4-phenyl-11-(2-pyridin-4-ylethyl)-13-oxa-2,4,5,11-tetrazatricyclo[7.4.0.03,7]trideca-1,3(7),5,8-tetraen-12-one |
| SMILES | Cc1nn(-c2ccccc2)c2nc3c(cc12)CN(CCc1ccncc1)C(=O)O3 |
| InChI | InChI=1S/C22H19N5O2/c1-15-19-13-17-14-26(12-9-16-7-10-23-11-8-16)22(28)29-21(17)24-20(19)27(25-15)18-5-3-2-4-6-18/h2-8,10-11,13H,9,12,14H2,1H3 |
| InChIKey | UNBYSVOAEUOKOP-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 73.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.43 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |