About propan-2-yl 2-[2-(4-methoxyphenyl)pyrrolo[2,3-b]pyridin-1-yl]acetate
propan-2-yl 2-[2-(4-methoxyphenyl)pyrrolo[2,3-b]pyridin-1-yl]acetate (PubChem CID 46962960) has the molecular formula C19H20N2O3
and a molecular weight of 324.38 g/mol. Its IUPAC name is propan-2-yl 2-[2-(4-methoxyphenyl)pyrrolo[2,3-b]pyridin-1-yl]acetate.
Molecular Properties
| Compound Name | propan-2-yl 2-[2-(4-methoxyphenyl)pyrrolo[2,3-b]pyridin-1-yl]acetate |
| PubChem CID | 46962960 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | propan-2-yl 2-[2-(4-methoxyphenyl)pyrrolo[2,3-b]pyridin-1-yl]acetate |
| SMILES | COc1ccc(-c2cc3cccnc3n2CC(=O)OC(C)C)cc1 |
| InChI | InChI=1S/C19H20N2O3/c1-13(2)24-18(22)12-21-17(11-15-5-4-10-20-19(15)21)14-6-8-16(23-3)9-7-14/h4-11,13H,12H2,1-3H3 |
| InChIKey | NLSZRRLNDHZUHF-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze propan-2-yl 2-[2-(4-methoxyphenyl)pyrrolo[2,3-b]pyridin-1-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 2-[2-(4-methoxyphenyl)pyrrolo[2,3-b]pyridin-1-yl]acetate?
The IUPAC name of propan-2-yl 2-[2-(4-methoxyphenyl)pyrrolo[2,3-b]pyridin-1-yl]acetate (CID 46962960) is propan-2-yl 2-[2-(4-methoxyphenyl)pyrrolo[2,3-b]pyridin-1-yl]acetate.
What is the SMILES notation for propan-2-yl 2-[2-(4-methoxyphenyl)pyrrolo[2,3-b]pyridin-1-yl]acetate?
The canonical SMILES for propan-2-yl 2-[2-(4-methoxyphenyl)pyrrolo[2,3-b]pyridin-1-yl]acetate is COc1ccc(-c2cc3cccnc3n2CC(=O)OC(C)C)cc1.
What is the InChIKey of propan-2-yl 2-[2-(4-methoxyphenyl)pyrrolo[2,3-b]pyridin-1-yl]acetate?
The InChIKey is NLSZRRLNDHZUHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N2O3/c1-13(2)24-18(22)12-21-17(11-15-5-4-10-20-19(15)21)14-6-8-16(23-3)9-7-14/h4-11,13H,12H2,1-3H3.
What are the key properties of propan-2-yl 2-[2-(4-methoxyphenyl)pyrrolo[2,3-b]pyridin-1-yl]acetate?
propan-2-yl 2-[2-(4-methoxyphenyl)pyrrolo[2,3-b]pyridin-1-yl]acetate has a molecular weight of 324.38 g/mol, XLogP of 3.66, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 2-[2-(4-methoxyphenyl)pyrrolo[2,3-b]pyridin-1-yl]acetate is sourced from PubChem (CID 46962960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).