About 1-cyclohexyl-4-[(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)methyl]piperazin-2-one
1-cyclohexyl-4-[(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)methyl]piperazin-2-one (PubChem CID 46963063) has the molecular formula C19H32N4O
and a molecular weight of 332.49 g/mol. Its IUPAC name is 1-cyclohexyl-4-[(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)methyl]piperazin-2-one.
Molecular Properties
| Compound Name | 1-cyclohexyl-4-[(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)methyl]piperazin-2-one |
| PubChem CID | 46963063 |
| Molecular Formula | C19H32N4O |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.26 |
| IUPAC Name | 1-cyclohexyl-4-[(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)methyl]piperazin-2-one |
| SMILES | Cc1nn(C(C)C)c(C)c1CN1CCN(C2CCCCC2)C(=O)C1 |
| InChI | InChI=1S/C19H32N4O/c1-14(2)23-16(4)18(15(3)20-23)12-21-10-11-22(19(24)13-21)17-8-6-5-7-9-17/h14,17H,5-13H2,1-4H3 |
| InChIKey | ZLLMITDKZPRQOT-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-cyclohexyl-4-[(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)methyl]piperazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-4-[(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)methyl]piperazin-2-one?
The IUPAC name of 1-cyclohexyl-4-[(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)methyl]piperazin-2-one (CID 46963063) is 1-cyclohexyl-4-[(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)methyl]piperazin-2-one.
What is the SMILES notation for 1-cyclohexyl-4-[(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)methyl]piperazin-2-one?
The canonical SMILES for 1-cyclohexyl-4-[(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)methyl]piperazin-2-one is Cc1nn(C(C)C)c(C)c1CN1CCN(C2CCCCC2)C(=O)C1.
What is the InChIKey of 1-cyclohexyl-4-[(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)methyl]piperazin-2-one?
The InChIKey is ZLLMITDKZPRQOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H32N4O/c1-14(2)23-16(4)18(15(3)20-23)12-21-10-11-22(19(24)13-21)17-8-6-5-7-9-17/h14,17H,5-13H2,1-4H3.
What are the key properties of 1-cyclohexyl-4-[(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)methyl]piperazin-2-one?
1-cyclohexyl-4-[(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)methyl]piperazin-2-one has a molecular weight of 332.49 g/mol, XLogP of 3.06, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-4-[(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)methyl]piperazin-2-one is sourced from PubChem (CID 46963063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).