C23H30N4O — CID 46964905
1-(6,7-dimethyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-3-(3,4,5-trimethylpyrazol-1-yl)butan-1-one (PubChem CID 46964905) has the molecular formula C23H30N4O and a molecular weight of 378.52 g/mol. Its IUPAC name is 1-(6,7-dimethyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-3-(3,4,5-trimethylpyrazol-1-yl)butan-1-one.
| Compound Name | 1-(6,7-dimethyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-3-(3,4,5-trimethylpyrazol-1-yl)butan-1-one |
|---|---|
| PubChem CID | 46964905 |
| Molecular Formula | C23H30N4O |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | 1-(6,7-dimethyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-3-(3,4,5-trimethylpyrazol-1-yl)butan-1-one |
| SMILES | Cc1ccc2c3c([nH]c2c1C)CCN(C(=O)CC(C)n1nc(C)c(C)c1C)C3 |
| InChI | InChI=1S/C23H30N4O/c1-13-7-8-19-20-12-26(10-9-21(20)24-23(19)15(13)3)22(28)11-14(2)27-18(6)16(4)17(5)25-27/h7-8,14,24H,9-12H2,1-6H3 |
| InChIKey | XQLFRASZMYMASP-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 53.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|