C22H25N3O2 — CID 46964932
(2,3-dimethyl-1H-indol-6-yl)-[4-(pyridin-2-yloxymethyl)piperidin-1-yl]methanone (PubChem CID 46964932) has the molecular formula C22H25N3O2 and a molecular weight of 363.46 g/mol. Its IUPAC name is (2,3-dimethyl-1H-indol-6-yl)-[4-(pyridin-2-yloxymethyl)piperidin-1-yl]methanone.
| Compound Name | (2,3-dimethyl-1H-indol-6-yl)-[4-(pyridin-2-yloxymethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 46964932 |
| Molecular Formula | C22H25N3O2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | (2,3-dimethyl-1H-indol-6-yl)-[4-(pyridin-2-yloxymethyl)piperidin-1-yl]methanone |
| SMILES | Cc1[nH]c2cc(C(=O)N3CCC(COc4ccccn4)CC3)ccc2c1C |
| InChI | InChI=1S/C22H25N3O2/c1-15-16(2)24-20-13-18(6-7-19(15)20)22(26)25-11-8-17(9-12-25)14-27-21-5-3-4-10-23-21/h3-7,10,13,17,24H,8-9,11-12,14H2,1-2H3 |
| InChIKey | LPTYXJGLHRBMNI-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|