C21H32FN3O2 — CID 46965059
2-(azepan-1-yl)-N-[2-[4-(4-fluorophenyl)-4-hydroxypiperidin-1-yl]ethyl]acetamide (PubChem CID 46965059) has the molecular formula C21H32FN3O2 and a molecular weight of 377.50 g/mol. Its IUPAC name is 2-(azepan-1-yl)-N-[2-[4-(4-fluorophenyl)-4-hydroxypiperidin-1-yl]ethyl]acetamide.
| Compound Name | 2-(azepan-1-yl)-N-[2-[4-(4-fluorophenyl)-4-hydroxypiperidin-1-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 46965059 |
| Molecular Formula | C21H32FN3O2 |
| Molecular Weight | 377.50 g/mol |
| Exact Mass | 377.25 |
| IUPAC Name | 2-(azepan-1-yl)-N-[2-[4-(4-fluorophenyl)-4-hydroxypiperidin-1-yl]ethyl]acetamide |
| SMILES | O=C(CN1CCCCCC1)NCCN1CCC(O)(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C21H32FN3O2/c22-19-7-5-18(6-8-19)21(27)9-14-24(15-10-21)16-11-23-20(26)17-25-12-3-1-2-4-13-25/h5-8,27H,1-4,9-17H2,(H,23,26) |
| InChIKey | BZWJPIMBHQEQLT-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.50 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |