C25H27FN4O — CID 46965174
[4-(2-tert-butyl-5-pyridin-4-ylpyrimidin-4-yl)piperidin-1-yl]-(4-fluorophenyl)methanone (PubChem CID 46965174) has the molecular formula C25H27FN4O and a molecular weight of 418.52 g/mol. Its IUPAC name is [4-(2-tert-butyl-5-pyridin-4-ylpyrimidin-4-yl)piperidin-1-yl]-(4-fluorophenyl)methanone.
| Compound Name | [4-(2-tert-butyl-5-pyridin-4-ylpyrimidin-4-yl)piperidin-1-yl]-(4-fluorophenyl)methanone |
|---|---|
| PubChem CID | 46965174 |
| Molecular Formula | C25H27FN4O |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | [4-(2-tert-butyl-5-pyridin-4-ylpyrimidin-4-yl)piperidin-1-yl]-(4-fluorophenyl)methanone |
| SMILES | CC(C)(C)c1ncc(-c2ccncc2)c(C2CCN(C(=O)c3ccc(F)cc3)CC2)n1 |
| InChI | InChI=1S/C25H27FN4O/c1-25(2,3)24-28-16-21(17-8-12-27-13-9-17)22(29-24)18-10-14-30(15-11-18)23(31)19-4-6-20(26)7-5-19/h4-9,12-13,16,18H,10-11,14-15H2,1-3H3 |
| InChIKey | YVNIQMNZYNLVKW-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 58.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |