C23H21FN4O — CID 46965507
N-[3-[2-(4-fluorophenyl)pyrrolo[2,3-b]pyridin-1-yl]propyl]-2-methylpyridine-3-carboxamide (PubChem CID 46965507) has the molecular formula C23H21FN4O and a molecular weight of 388.45 g/mol. Its IUPAC name is N-[3-[2-(4-fluorophenyl)pyrrolo[2,3-b]pyridin-1-yl]propyl]-2-methylpyridine-3-carboxamide.
| Compound Name | N-[3-[2-(4-fluorophenyl)pyrrolo[2,3-b]pyridin-1-yl]propyl]-2-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 46965507 |
| Molecular Formula | C23H21FN4O |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | N-[3-[2-(4-fluorophenyl)pyrrolo[2,3-b]pyridin-1-yl]propyl]-2-methylpyridine-3-carboxamide |
| SMILES | Cc1ncccc1C(=O)NCCCn1c(-c2ccc(F)cc2)cc2cccnc21 |
| InChI | InChI=1S/C23H21FN4O/c1-16-20(6-3-11-25-16)23(29)27-13-4-14-28-21(17-7-9-19(24)10-8-17)15-18-5-2-12-26-22(18)28/h2-3,5-12,15H,4,13-14H2,1H3,(H,27,29) |
| InChIKey | CPOLCAOQKVZOBI-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|