About 1-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-4-(2-methoxyphenyl)piperidin-4-ol
1-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-4-(2-methoxyphenyl)piperidin-4-ol (PubChem CID 46966161) has the molecular formula C20H29N3O2
and a molecular weight of 343.47 g/mol. Its IUPAC name is 1-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-4-(2-methoxyphenyl)piperidin-4-ol.
Molecular Properties
| Compound Name | 1-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-4-(2-methoxyphenyl)piperidin-4-ol |
| PubChem CID | 46966161 |
| Molecular Formula | C20H29N3O2 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | 1-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-4-(2-methoxyphenyl)piperidin-4-ol |
| SMILES | CCn1nc(C)c(CN2CCC(O)(c3ccccc3OC)CC2)c1C |
| InChI | InChI=1S/C20H29N3O2/c1-5-23-16(3)17(15(2)21-23)14-22-12-10-20(24,11-13-22)18-8-6-7-9-19(18)25-4/h6-9,24H,5,10-14H2,1-4H3 |
| InChIKey | MWYDGYXCJXLNEZ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-4-(2-methoxyphenyl)piperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-4-(2-methoxyphenyl)piperidin-4-ol?
The IUPAC name of 1-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-4-(2-methoxyphenyl)piperidin-4-ol (CID 46966161) is 1-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-4-(2-methoxyphenyl)piperidin-4-ol.
What is the SMILES notation for 1-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-4-(2-methoxyphenyl)piperidin-4-ol?
The canonical SMILES for 1-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-4-(2-methoxyphenyl)piperidin-4-ol is CCn1nc(C)c(CN2CCC(O)(c3ccccc3OC)CC2)c1C.
What is the InChIKey of 1-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-4-(2-methoxyphenyl)piperidin-4-ol?
The InChIKey is MWYDGYXCJXLNEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H29N3O2/c1-5-23-16(3)17(15(2)21-23)14-22-12-10-20(24,11-13-22)18-8-6-7-9-19(18)25-4/h6-9,24H,5,10-14H2,1-4H3.
What are the key properties of 1-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-4-(2-methoxyphenyl)piperidin-4-ol?
1-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-4-(2-methoxyphenyl)piperidin-4-ol has a molecular weight of 343.47 g/mol, XLogP of 3.01, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-4-(2-methoxyphenyl)piperidin-4-ol is sourced from PubChem (CID 46966161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).