C20H22F2N4O3 — CID 46967710
12-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-5-methyl-2,6,7,12-tetrazatricyclo[7.5.0.03,7]tetradeca-1(9),2,4-trien-8-one (PubChem CID 46967710) has the molecular formula C20H22F2N4O3 and a molecular weight of 404.42 g/mol. Its IUPAC name is 12-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-5-methyl-2,6,7,12-tetrazatricyclo[7.5.0.03,7]tetradeca-1(9),2,4-trien-8-one.
| Compound Name | 12-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-5-methyl-2,6,7,12-tetrazatricyclo[7.5.0.03,7]tetradeca-1(9),2,4-trien-8-one |
|---|---|
| PubChem CID | 46967710 |
| Molecular Formula | C20H22F2N4O3 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | 12-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-5-methyl-2,6,7,12-tetrazatricyclo[7.5.0.03,7]tetradeca-1(9),2,4-trien-8-one |
| SMILES | COc1cc(CN2CCc3nc4cc(C)[nH]n4c(=O)c3CC2)ccc1OC(F)F |
| InChI | InChI=1S/C20H22F2N4O3/c1-12-9-18-23-15-6-8-25(7-5-14(15)19(27)26(18)24-12)11-13-3-4-16(29-20(21)22)17(10-13)28-2/h3-4,9-10,20,24H,5-8,11H2,1-2H3 |
| InChIKey | AKCXAIXSASAOFU-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 71.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |