About 3-(1,3-dimethylpyrazol-4-yl)-N-(2-piperidin-1-ylsulfonylethyl)-1,2-oxazole-5-carboxamide
3-(1,3-dimethylpyrazol-4-yl)-N-(2-piperidin-1-ylsulfonylethyl)-1,2-oxazole-5-carboxamide (PubChem CID 46969423) has the molecular formula C16H23N5O4S
and a molecular weight of 381.46 g/mol. Its IUPAC name is 3-(1,3-dimethylpyrazol-4-yl)-N-(2-piperidin-1-ylsulfonylethyl)-1,2-oxazole-5-carboxamide.
Molecular Properties
| Compound Name | 3-(1,3-dimethylpyrazol-4-yl)-N-(2-piperidin-1-ylsulfonylethyl)-1,2-oxazole-5-carboxamide |
| PubChem CID | 46969423 |
| Molecular Formula | C16H23N5O4S |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | 3-(1,3-dimethylpyrazol-4-yl)-N-(2-piperidin-1-ylsulfonylethyl)-1,2-oxazole-5-carboxamide |
| SMILES | Cc1nn(C)cc1-c1cc(C(=O)NCCS(=O)(=O)N2CCCCC2)on1 |
| InChI | InChI=1S/C16H23N5O4S/c1-12-13(11-20(2)18-12)14-10-15(25-19-14)16(22)17-6-9-26(23,24)21-7-4-3-5-8-21/h10-11H,3-9H2,1-2H3,(H,17,22) |
| InChIKey | PCZDWOVBQGDOMU-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 110.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-(1,3-dimethylpyrazol-4-yl)-N-(2-piperidin-1-ylsulfonylethyl)-1,2-oxazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,3-dimethylpyrazol-4-yl)-N-(2-piperidin-1-ylsulfonylethyl)-1,2-oxazole-5-carboxamide?
The IUPAC name of 3-(1,3-dimethylpyrazol-4-yl)-N-(2-piperidin-1-ylsulfonylethyl)-1,2-oxazole-5-carboxamide (CID 46969423) is 3-(1,3-dimethylpyrazol-4-yl)-N-(2-piperidin-1-ylsulfonylethyl)-1,2-oxazole-5-carboxamide.
What is the SMILES notation for 3-(1,3-dimethylpyrazol-4-yl)-N-(2-piperidin-1-ylsulfonylethyl)-1,2-oxazole-5-carboxamide?
The canonical SMILES for 3-(1,3-dimethylpyrazol-4-yl)-N-(2-piperidin-1-ylsulfonylethyl)-1,2-oxazole-5-carboxamide is Cc1nn(C)cc1-c1cc(C(=O)NCCS(=O)(=O)N2CCCCC2)on1.
What is the InChIKey of 3-(1,3-dimethylpyrazol-4-yl)-N-(2-piperidin-1-ylsulfonylethyl)-1,2-oxazole-5-carboxamide?
The InChIKey is PCZDWOVBQGDOMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23N5O4S/c1-12-13(11-20(2)18-12)14-10-15(25-19-14)16(22)17-6-9-26(23,24)21-7-4-3-5-8-21/h10-11H,3-9H2,1-2H3,(H,17,22).
What are the key properties of 3-(1,3-dimethylpyrazol-4-yl)-N-(2-piperidin-1-ylsulfonylethyl)-1,2-oxazole-5-carboxamide?
3-(1,3-dimethylpyrazol-4-yl)-N-(2-piperidin-1-ylsulfonylethyl)-1,2-oxazole-5-carboxamide has a molecular weight of 381.46 g/mol, XLogP of 0.93, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,3-dimethylpyrazol-4-yl)-N-(2-piperidin-1-ylsulfonylethyl)-1,2-oxazole-5-carboxamide is sourced from PubChem (CID 46969423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).