C21H22FN3O4 — CID 46969735
N-[4-[(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)methyl]phenyl]-2-(3-fluorophenoxy)propanamide (PubChem CID 46969735) has the molecular formula C21H22FN3O4 and a molecular weight of 399.42 g/mol. Its IUPAC name is N-[4-[(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)methyl]phenyl]-2-(3-fluorophenoxy)propanamide.
| Compound Name | N-[4-[(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)methyl]phenyl]-2-(3-fluorophenoxy)propanamide |
|---|---|
| PubChem CID | 46969735 |
| Molecular Formula | C21H22FN3O4 |
| Molecular Weight | 399.42 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | N-[4-[(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)methyl]phenyl]-2-(3-fluorophenoxy)propanamide |
| SMILES | CC(Oc1cccc(F)c1)C(=O)Nc1ccc(CN2C(=O)NC(C)(C)C2=O)cc1 |
| InChI | InChI=1S/C21H22FN3O4/c1-13(29-17-6-4-5-15(22)11-17)18(26)23-16-9-7-14(8-10-16)12-25-19(27)21(2,3)24-20(25)28/h4-11,13H,12H2,1-3H3,(H,23,26)(H,24,28) |
| InChIKey | SYBMYCFGXOHIKV-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.42 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|