C21H22FN5O3 — CID 46970429
N-(3-fluoro-4-morpholin-4-ylphenyl)-4-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)butanamide (PubChem CID 46970429) has the molecular formula C21H22FN5O3 and a molecular weight of 411.44 g/mol. Its IUPAC name is N-(3-fluoro-4-morpholin-4-ylphenyl)-4-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)butanamide.
| Compound Name | N-(3-fluoro-4-morpholin-4-ylphenyl)-4-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)butanamide |
|---|---|
| PubChem CID | 46970429 |
| Molecular Formula | C21H22FN5O3 |
| Molecular Weight | 411.44 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | N-(3-fluoro-4-morpholin-4-ylphenyl)-4-(3-pyridin-2-yl-1,2,4-oxadiazol-5-yl)butanamide |
| SMILES | O=C(CCCc1nc(-c2ccccn2)no1)Nc1ccc(N2CCOCC2)c(F)c1 |
| InChI | InChI=1S/C21H22FN5O3/c22-16-14-15(7-8-18(16)27-10-12-29-13-11-27)24-19(28)5-3-6-20-25-21(26-30-20)17-4-1-2-9-23-17/h1-2,4,7-9,14H,3,5-6,10-13H2,(H,24,28) |
| InChIKey | JZEUUNSREJBKEV-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 93.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.44 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|