C20H24N4O2 — CID 46970461
2-[2-(dimethylamino)ethoxy]-N-(1-ethylbenzimidazol-2-yl)benzamide (PubChem CID 46970461) has the molecular formula C20H24N4O2 and a molecular weight of 352.44 g/mol. Its IUPAC name is 2-[2-(dimethylamino)ethoxy]-N-(1-ethylbenzimidazol-2-yl)benzamide.
| Compound Name | 2-[2-(dimethylamino)ethoxy]-N-(1-ethylbenzimidazol-2-yl)benzamide |
|---|---|
| PubChem CID | 46970461 |
| Molecular Formula | C20H24N4O2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | 2-[2-(dimethylamino)ethoxy]-N-(1-ethylbenzimidazol-2-yl)benzamide |
| SMILES | CCn1c(NC(=O)c2ccccc2OCCN(C)C)nc2ccccc21 |
| InChI | InChI=1S/C20H24N4O2/c1-4-24-17-11-7-6-10-16(17)21-20(24)22-19(25)15-9-5-8-12-18(15)26-14-13-23(2)3/h5-12H,4,13-14H2,1-3H3,(H,21,22,25) |
| InChIKey | LPTAXDXQYIZXEX-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |