C25H23N3O3 — CID 46971644
6-(4-methoxyphenyl)-3-(6-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carbonyl)-1H-pyridin-2-one (PubChem CID 46971644) has the molecular formula C25H23N3O3 and a molecular weight of 413.48 g/mol. Its IUPAC name is 6-(4-methoxyphenyl)-3-(6-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carbonyl)-1H-pyridin-2-one.
| Compound Name | 6-(4-methoxyphenyl)-3-(6-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carbonyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 46971644 |
| Molecular Formula | C25H23N3O3 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | 6-(4-methoxyphenyl)-3-(6-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carbonyl)-1H-pyridin-2-one |
| SMILES | COc1ccc(-c2ccc(C(=O)N3CCc4[nH]c5c(C)cccc5c4C3)c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C25H23N3O3/c1-15-4-3-5-18-20-14-28(13-12-22(20)26-23(15)18)25(30)19-10-11-21(27-24(19)29)16-6-8-17(31-2)9-7-16/h3-11,26H,12-14H2,1-2H3,(H,27,29) |
| InChIKey | NRSVQFSXXGXQEP-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 78.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|