C26H30N2O4 — CID 4697225
1-[2-(dimethylamino)ethyl]-4-hydroxy-3-(3-phenylprop-2-enoyl)-2-(3-propoxyphenyl)-2H-pyrrol-5-one (PubChem CID 4697225) has the molecular formula C26H30N2O4 and a molecular weight of 434.54 g/mol. Its IUPAC name is 1-[2-(dimethylamino)ethyl]-4-hydroxy-3-(3-phenylprop-2-enoyl)-2-(3-propoxyphenyl)-2H-pyrrol-5-one.
| Compound Name | 1-[2-(dimethylamino)ethyl]-4-hydroxy-3-(3-phenylprop-2-enoyl)-2-(3-propoxyphenyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 4697225 |
| Molecular Formula | C26H30N2O4 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | 1-[2-(dimethylamino)ethyl]-4-hydroxy-3-(3-phenylprop-2-enoyl)-2-(3-propoxyphenyl)-2H-pyrrol-5-one |
| SMILES | CCCOc1cccc(C2C(C(=O)C=Cc3ccccc3)=C(O)C(=O)N2CCN(C)C)c1 |
| InChI | InChI=1S/C26H30N2O4/c1-4-17-32-21-12-8-11-20(18-21)24-23(22(29)14-13-19-9-6-5-7-10-19)25(30)26(31)28(24)16-15-27(2)3/h5-14,18,24,30H,4,15-17H2,1-3H3 |
| InChIKey | NXDCSWMZFDRZEM-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|