C20H21FN2O2 — CID 46972664
[(1R,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]methanone (PubChem CID 46972664) has the molecular formula C20H21FN2O2 and a molecular weight of 340.40 g/mol. Its IUPAC name is [(1R,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]methanone.
| Compound Name | [(1R,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 46972664 |
| Molecular Formula | C20H21FN2O2 |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | [(1R,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]methanone |
| SMILES | O=C([C@@H]1C[C@@H]2C=C[C@H]1C2)N1CCC(c2noc3cc(F)ccc23)CC1 |
| InChI | InChI=1S/C20H21FN2O2/c21-15-3-4-16-18(11-15)25-22-19(16)13-5-7-23(8-6-13)20(24)17-10-12-1-2-14(17)9-12/h1-4,11-14,17H,5-10H2/t12-,14+,17-/m1/s1 |
| InChIKey | XMCFBBQFKWWEQR-HACGYAERSA-N |
| XLogP | 3.89 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|