C21H23N5O3 — CID 46972745
2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)-N-[4-(1,2,4-triazol-1-ylmethyl)phenyl]propanamide (PubChem CID 46972745) has the molecular formula C21H23N5O3 and a molecular weight of 393.45 g/mol. Its IUPAC name is 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)-N-[4-(1,2,4-triazol-1-ylmethyl)phenyl]propanamide.
| Compound Name | 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)-N-[4-(1,2,4-triazol-1-ylmethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 46972745 |
| Molecular Formula | C21H23N5O3 |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)-N-[4-(1,2,4-triazol-1-ylmethyl)phenyl]propanamide |
| SMILES | CC(C(=O)Nc1ccc(Cn2cncn2)cc1)N1C(=O)C2C3CCC(C3)C2C1=O |
| InChI | InChI=1S/C21H23N5O3/c1-12(26-20(28)17-14-4-5-15(8-14)18(17)21(26)29)19(27)24-16-6-2-13(3-7-16)9-25-11-22-10-23-25/h2-3,6-7,10-12,14-15,17-18H,4-5,8-9H2,1H3,(H,24,27) |
| InChIKey | CDVXRGLBHMTXLK-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|