C18H14N4O3 — CID 46973153
5-methyl-N-(1-oxo-3H-2-benzofuran-5-yl)-3-phenyltriazole-4-carboxamide (PubChem CID 46973153) has the molecular formula C18H14N4O3 and a molecular weight of 334.34 g/mol. Its IUPAC name is 5-methyl-N-(1-oxo-3H-2-benzofuran-5-yl)-3-phenyltriazole-4-carboxamide.
| Compound Name | 5-methyl-N-(1-oxo-3H-2-benzofuran-5-yl)-3-phenyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 46973153 |
| Molecular Formula | C18H14N4O3 |
| Molecular Weight | 334.34 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 5-methyl-N-(1-oxo-3H-2-benzofuran-5-yl)-3-phenyltriazole-4-carboxamide |
| SMILES | Cc1nnn(-c2ccccc2)c1C(=O)Nc1ccc2c(c1)COC2=O |
| InChI | InChI=1S/C18H14N4O3/c1-11-16(22(21-20-11)14-5-3-2-4-6-14)17(23)19-13-7-8-15-12(9-13)10-25-18(15)24/h2-9H,10H2,1H3,(H,19,23) |
| InChIKey | RVHILSPMDTUHBF-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.34 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |