About 1'-[2-(benzotriazol-1-yl)propanoyl]-7-methoxyspiro[3H-chromene-2,4'-piperidine]-4-one
1'-[2-(benzotriazol-1-yl)propanoyl]-7-methoxyspiro[3H-chromene-2,4'-piperidine]-4-one (PubChem CID 46973228) has the molecular formula C23H24N4O4
and a molecular weight of 420.47 g/mol. Its IUPAC name is 1'-[2-(benzotriazol-1-yl)propanoyl]-7-methoxyspiro[3H-chromene-2,4'-piperidine]-4-one.
Molecular Properties
| Compound Name | 1'-[2-(benzotriazol-1-yl)propanoyl]-7-methoxyspiro[3H-chromene-2,4'-piperidine]-4-one |
| PubChem CID | 46973228 |
| Molecular Formula | C23H24N4O4 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | 1'-[2-(benzotriazol-1-yl)propanoyl]-7-methoxyspiro[3H-chromene-2,4'-piperidine]-4-one |
| SMILES | COc1ccc2c(c1)OC1(CCN(C(=O)C(C)n3nnc4ccccc43)CC1)CC2=O |
| InChI | InChI=1S/C23H24N4O4/c1-15(27-19-6-4-3-5-18(19)24-25-27)22(29)26-11-9-23(10-12-26)14-20(28)17-8-7-16(30-2)13-21(17)31-23/h3-8,13,15H,9-12,14H2,1-2H3 |
| InChIKey | IVISTCCVOWPWCV-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 86.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1'-[2-(benzotriazol-1-yl)propanoyl]-7-methoxyspiro[3H-chromene-2,4'-piperidine]-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1'-[2-(benzotriazol-1-yl)propanoyl]-7-methoxyspiro[3H-chromene-2,4'-piperidine]-4-one?
The IUPAC name of 1'-[2-(benzotriazol-1-yl)propanoyl]-7-methoxyspiro[3H-chromene-2,4'-piperidine]-4-one (CID 46973228) is 1'-[2-(benzotriazol-1-yl)propanoyl]-7-methoxyspiro[3H-chromene-2,4'-piperidine]-4-one.
What is the SMILES notation for 1'-[2-(benzotriazol-1-yl)propanoyl]-7-methoxyspiro[3H-chromene-2,4'-piperidine]-4-one?
The canonical SMILES for 1'-[2-(benzotriazol-1-yl)propanoyl]-7-methoxyspiro[3H-chromene-2,4'-piperidine]-4-one is COc1ccc2c(c1)OC1(CCN(C(=O)C(C)n3nnc4ccccc43)CC1)CC2=O.
What is the InChIKey of 1'-[2-(benzotriazol-1-yl)propanoyl]-7-methoxyspiro[3H-chromene-2,4'-piperidine]-4-one?
The InChIKey is IVISTCCVOWPWCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H24N4O4/c1-15(27-19-6-4-3-5-18(19)24-25-27)22(29)26-11-9-23(10-12-26)14-20(28)17-8-7-16(30-2)13-21(17)31-23/h3-8,13,15H,9-12,14H2,1-2H3.
What are the key properties of 1'-[2-(benzotriazol-1-yl)propanoyl]-7-methoxyspiro[3H-chromene-2,4'-piperidine]-4-one?
1'-[2-(benzotriazol-1-yl)propanoyl]-7-methoxyspiro[3H-chromene-2,4'-piperidine]-4-one has a molecular weight of 420.47 g/mol, XLogP of 3.03, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1'-[2-(benzotriazol-1-yl)propanoyl]-7-methoxyspiro[3H-chromene-2,4'-piperidine]-4-one is sourced from PubChem (CID 46973228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).