C20H19ClN2O2 — CID 46973928
(3aS,10aS)-2-[(2-chlorophenyl)methyl]-10a-methyl-1,3,3a,4-tetrahydropyrrolo[3,4-c][2]benzazepine-5,10-dione (PubChem CID 46973928) has the molecular formula C20H19ClN2O2 and a molecular weight of 354.84 g/mol. Its IUPAC name is (3aS,10aS)-2-[(2-chlorophenyl)methyl]-10a-methyl-1,3,3a,4-tetrahydropyrrolo[3,4-c][2]benzazepine-5,10-dione.
| Compound Name | (3aS,10aS)-2-[(2-chlorophenyl)methyl]-10a-methyl-1,3,3a,4-tetrahydropyrrolo[3,4-c][2]benzazepine-5,10-dione |
|---|---|
| PubChem CID | 46973928 |
| Molecular Formula | C20H19ClN2O2 |
| Molecular Weight | 354.84 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | (3aS,10aS)-2-[(2-chlorophenyl)methyl]-10a-methyl-1,3,3a,4-tetrahydropyrrolo[3,4-c][2]benzazepine-5,10-dione |
| SMILES | C[C@]12CN(Cc3ccccc3Cl)C[C@H]1NC(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C20H19ClN2O2/c1-20-12-23(10-13-6-2-5-9-16(13)21)11-17(20)22-19(25)15-8-4-3-7-14(15)18(20)24/h2-9,17H,10-12H2,1H3,(H,22,25)/t17-,20+/m1/s1 |
| InChIKey | GXCDRZZIEAPTBO-XLIONFOSSA-N |
| XLogP | 3.16 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.84 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |