C18H20N6O3S — CID 46974468
N-[[4-(dimethylsulfamoyl)phenyl]methyl]-4-(5-methyltetrazol-1-yl)benzamide (PubChem CID 46974468) has the molecular formula C18H20N6O3S and a molecular weight of 400.46 g/mol. Its IUPAC name is N-[[4-(dimethylsulfamoyl)phenyl]methyl]-4-(5-methyltetrazol-1-yl)benzamide.
| Compound Name | N-[[4-(dimethylsulfamoyl)phenyl]methyl]-4-(5-methyltetrazol-1-yl)benzamide |
|---|---|
| PubChem CID | 46974468 |
| Molecular Formula | C18H20N6O3S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | N-[[4-(dimethylsulfamoyl)phenyl]methyl]-4-(5-methyltetrazol-1-yl)benzamide |
| SMILES | Cc1nnnn1-c1ccc(C(=O)NCc2ccc(S(=O)(=O)N(C)C)cc2)cc1 |
| InChI | InChI=1S/C18H20N6O3S/c1-13-20-21-22-24(13)16-8-6-15(7-9-16)18(25)19-12-14-4-10-17(11-5-14)28(26,27)23(2)3/h4-11H,12H2,1-3H3,(H,19,25) |
| InChIKey | WXUKZSDGKBSVMZ-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |