C24H30N4O2 — CID 46976087
2-(2-ethylbenzimidazol-1-yl)-N-methyl-N-[(2-morpholin-4-ylphenyl)methyl]propanamide (PubChem CID 46976087) has the molecular formula C24H30N4O2 and a molecular weight of 406.53 g/mol. Its IUPAC name is 2-(2-ethylbenzimidazol-1-yl)-N-methyl-N-[(2-morpholin-4-ylphenyl)methyl]propanamide.
| Compound Name | 2-(2-ethylbenzimidazol-1-yl)-N-methyl-N-[(2-morpholin-4-ylphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 46976087 |
| Molecular Formula | C24H30N4O2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | 2-(2-ethylbenzimidazol-1-yl)-N-methyl-N-[(2-morpholin-4-ylphenyl)methyl]propanamide |
| SMILES | CCc1nc2ccccc2n1C(C)C(=O)N(C)Cc1ccccc1N1CCOCC1 |
| InChI | InChI=1S/C24H30N4O2/c1-4-23-25-20-10-6-8-12-22(20)28(23)18(2)24(29)26(3)17-19-9-5-7-11-21(19)27-13-15-30-16-14-27/h5-12,18H,4,13-17H2,1-3H3 |
| InChIKey | XJWRZYGCCMUOMQ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |