C22H20FN3O2 — CID 46976195
N-[2-(5-fluoro-1-methylindol-3-yl)ethyl]-1-methyl-2-oxoquinoline-4-carboxamide (PubChem CID 46976195) has the molecular formula C22H20FN3O2 and a molecular weight of 377.42 g/mol. Its IUPAC name is N-[2-(5-fluoro-1-methylindol-3-yl)ethyl]-1-methyl-2-oxoquinoline-4-carboxamide.
| Compound Name | N-[2-(5-fluoro-1-methylindol-3-yl)ethyl]-1-methyl-2-oxoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 46976195 |
| Molecular Formula | C22H20FN3O2 |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | N-[2-(5-fluoro-1-methylindol-3-yl)ethyl]-1-methyl-2-oxoquinoline-4-carboxamide |
| SMILES | Cn1cc(CCNC(=O)c2cc(=O)n(C)c3ccccc23)c2cc(F)ccc21 |
| InChI | InChI=1S/C22H20FN3O2/c1-25-13-14(17-11-15(23)7-8-19(17)25)9-10-24-22(28)18-12-21(27)26(2)20-6-4-3-5-16(18)20/h3-8,11-13H,9-10H2,1-2H3,(H,24,28) |
| InChIKey | PPVUDJPWIGYBHE-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 56.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |