C20H25N5O — CID 46976546
1,4,7-trimethyl-N-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)indole-2-carboxamide (PubChem CID 46976546) has the molecular formula C20H25N5O and a molecular weight of 351.45 g/mol. Its IUPAC name is 1,4,7-trimethyl-N-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)indole-2-carboxamide.
| Compound Name | 1,4,7-trimethyl-N-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)indole-2-carboxamide |
|---|---|
| PubChem CID | 46976546 |
| Molecular Formula | C20H25N5O |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.21 |
| IUPAC Name | 1,4,7-trimethyl-N-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)indole-2-carboxamide |
| SMILES | Cc1ccc(C)c2c1cc(C(=O)NCc1nnc3n1CCCCC3)n2C |
| InChI | InChI=1S/C20H25N5O/c1-13-8-9-14(2)19-15(13)11-16(24(19)3)20(26)21-12-18-23-22-17-7-5-4-6-10-25(17)18/h8-9,11H,4-7,10,12H2,1-3H3,(H,21,26) |
| InChIKey | IAIFMDXINMTGOA-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |