C24H31N3O3 — CID 46977369
4-methyl-3-morpholin-4-yl-N-[1-(4-morpholin-4-ylphenyl)ethyl]benzamide (PubChem CID 46977369) has the molecular formula C24H31N3O3 and a molecular weight of 409.53 g/mol. Its IUPAC name is 4-methyl-3-morpholin-4-yl-N-[1-(4-morpholin-4-ylphenyl)ethyl]benzamide.
| Compound Name | 4-methyl-3-morpholin-4-yl-N-[1-(4-morpholin-4-ylphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 46977369 |
| Molecular Formula | C24H31N3O3 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | 4-methyl-3-morpholin-4-yl-N-[1-(4-morpholin-4-ylphenyl)ethyl]benzamide |
| SMILES | Cc1ccc(C(=O)NC(C)c2ccc(N3CCOCC3)cc2)cc1N1CCOCC1 |
| InChI | InChI=1S/C24H31N3O3/c1-18-3-4-21(17-23(18)27-11-15-30-16-12-27)24(28)25-19(2)20-5-7-22(8-6-20)26-9-13-29-14-10-26/h3-8,17,19H,9-16H2,1-2H3,(H,25,28) |
| InChIKey | CNPDGQBRAPUODV-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|