C21H25N5O2 — CID 46980394
4-[5-[3-[2-(4-methoxy-3-methylphenyl)ethyl]imidazol-4-yl]pyrimidin-2-yl]morpholine (PubChem CID 46980394) has the molecular formula C21H25N5O2 and a molecular weight of 379.46 g/mol. Its IUPAC name is 4-[5-[3-[2-(4-methoxy-3-methylphenyl)ethyl]imidazol-4-yl]pyrimidin-2-yl]morpholine.
| Compound Name | 4-[5-[3-[2-(4-methoxy-3-methylphenyl)ethyl]imidazol-4-yl]pyrimidin-2-yl]morpholine |
|---|---|
| PubChem CID | 46980394 |
| Molecular Formula | C21H25N5O2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | 4-[5-[3-[2-(4-methoxy-3-methylphenyl)ethyl]imidazol-4-yl]pyrimidin-2-yl]morpholine |
| SMILES | COc1ccc(CCn2cncc2-c2cnc(N3CCOCC3)nc2)cc1C |
| InChI | InChI=1S/C21H25N5O2/c1-16-11-17(3-4-20(16)27-2)5-6-26-15-22-14-19(26)18-12-23-21(24-13-18)25-7-9-28-10-8-25/h3-4,11-15H,5-10H2,1-2H3 |
| InChIKey | KKPUZDAXHPTZPL-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 65.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |