C24H31N3O3 — CID 46981136
1-[[3-(3-methoxyphenyl)phenyl]methyl]-4-morpholin-4-ylpiperidine-4-carboxamide (PubChem CID 46981136) has the molecular formula C24H31N3O3 and a molecular weight of 409.53 g/mol. Its IUPAC name is 1-[[3-(3-methoxyphenyl)phenyl]methyl]-4-morpholin-4-ylpiperidine-4-carboxamide.
| Compound Name | 1-[[3-(3-methoxyphenyl)phenyl]methyl]-4-morpholin-4-ylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 46981136 |
| Molecular Formula | C24H31N3O3 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | 1-[[3-(3-methoxyphenyl)phenyl]methyl]-4-morpholin-4-ylpiperidine-4-carboxamide |
| SMILES | COc1cccc(-c2cccc(CN3CCC(C(N)=O)(N4CCOCC4)CC3)c2)c1 |
| InChI | InChI=1S/C24H31N3O3/c1-29-22-7-3-6-21(17-22)20-5-2-4-19(16-20)18-26-10-8-24(9-11-26,23(25)28)27-12-14-30-15-13-27/h2-7,16-17H,8-15,18H2,1H3,(H2,25,28) |
| InChIKey | VBQFCJCFHODYAW-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 68.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |