About 2-(1-cyclohexyl-2,5-dioxoimidazolidin-4-yl)-N-[2-[4-(dimethylamino)phenyl]ethyl]acetamide
2-(1-cyclohexyl-2,5-dioxoimidazolidin-4-yl)-N-[2-[4-(dimethylamino)phenyl]ethyl]acetamide (PubChem CID 46981421) has the molecular formula C21H30N4O3
and a molecular weight of 386.50 g/mol. Its IUPAC name is 2-(1-cyclohexyl-2,5-dioxoimidazolidin-4-yl)-N-[2-[4-(dimethylamino)phenyl]ethyl]acetamide.
Molecular Properties
| Compound Name | 2-(1-cyclohexyl-2,5-dioxoimidazolidin-4-yl)-N-[2-[4-(dimethylamino)phenyl]ethyl]acetamide |
| PubChem CID | 46981421 |
| Molecular Formula | C21H30N4O3 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | 2-(1-cyclohexyl-2,5-dioxoimidazolidin-4-yl)-N-[2-[4-(dimethylamino)phenyl]ethyl]acetamide |
| SMILES | CN(C)c1ccc(CCNC(=O)CC2NC(=O)N(C3CCCCC3)C2=O)cc1 |
| InChI | InChI=1S/C21H30N4O3/c1-24(2)16-10-8-15(9-11-16)12-13-22-19(26)14-18-20(27)25(21(28)23-18)17-6-4-3-5-7-17/h8-11,17-18H,3-7,12-14H2,1-2H3,(H,22,26)(H,23,28) |
| InChIKey | BVSKIHZDODFFPH-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-cyclohexyl-2,5-dioxoimidazolidin-4-yl)-N-[2-[4-(dimethylamino)phenyl]ethyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-cyclohexyl-2,5-dioxoimidazolidin-4-yl)-N-[2-[4-(dimethylamino)phenyl]ethyl]acetamide?
The IUPAC name of 2-(1-cyclohexyl-2,5-dioxoimidazolidin-4-yl)-N-[2-[4-(dimethylamino)phenyl]ethyl]acetamide (CID 46981421) is 2-(1-cyclohexyl-2,5-dioxoimidazolidin-4-yl)-N-[2-[4-(dimethylamino)phenyl]ethyl]acetamide.
What is the SMILES notation for 2-(1-cyclohexyl-2,5-dioxoimidazolidin-4-yl)-N-[2-[4-(dimethylamino)phenyl]ethyl]acetamide?
The canonical SMILES for 2-(1-cyclohexyl-2,5-dioxoimidazolidin-4-yl)-N-[2-[4-(dimethylamino)phenyl]ethyl]acetamide is CN(C)c1ccc(CCNC(=O)CC2NC(=O)N(C3CCCCC3)C2=O)cc1.
What is the InChIKey of 2-(1-cyclohexyl-2,5-dioxoimidazolidin-4-yl)-N-[2-[4-(dimethylamino)phenyl]ethyl]acetamide?
The InChIKey is BVSKIHZDODFFPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H30N4O3/c1-24(2)16-10-8-15(9-11-16)12-13-22-19(26)14-18-20(27)25(21(28)23-18)17-6-4-3-5-7-17/h8-11,17-18H,3-7,12-14H2,1-2H3,(H,22,26)(H,23,28).
What are the key properties of 2-(1-cyclohexyl-2,5-dioxoimidazolidin-4-yl)-N-[2-[4-(dimethylamino)phenyl]ethyl]acetamide?
2-(1-cyclohexyl-2,5-dioxoimidazolidin-4-yl)-N-[2-[4-(dimethylamino)phenyl]ethyl]acetamide has a molecular weight of 386.50 g/mol, XLogP of 2.05, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-cyclohexyl-2,5-dioxoimidazolidin-4-yl)-N-[2-[4-(dimethylamino)phenyl]ethyl]acetamide is sourced from PubChem (CID 46981421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).