C18H24N4O3 — CID 46982463
methyl (3aS,6aS)-5-[(E)-hex-3-enoyl]-2-pyrimidin-2-yl-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylate (PubChem CID 46982463) has the molecular formula C18H24N4O3 and a molecular weight of 344.42 g/mol. Its IUPAC name is methyl (3aS,6aS)-5-[(E)-hex-3-enoyl]-2-pyrimidin-2-yl-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylate.
| Compound Name | methyl (3aS,6aS)-5-[(E)-hex-3-enoyl]-2-pyrimidin-2-yl-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylate |
|---|---|
| PubChem CID | 46982463 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | methyl (3aS,6aS)-5-[(E)-hex-3-enoyl]-2-pyrimidin-2-yl-3,4,6,6a-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-3a-carboxylate |
| SMILES | CC/C=C/CC(=O)N1C[C@@H]2CN(c3ncccn3)C[C@]2(C(=O)OC)C1 |
| InChI | InChI=1S/C18H24N4O3/c1-3-4-5-7-15(23)21-10-14-11-22(17-19-8-6-9-20-17)13-18(14,12-21)16(24)25-2/h4-6,8-9,14H,3,7,10-13H2,1-2H3/b5-4+/t14-,18-/m1/s1 |
| InChIKey | KNMXWGJJDCBRQQ-FHWYHTKLSA-N |
| XLogP | 1.27 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|