C33H24Cl2N4O4S2 — CID 4698284
1-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-[hydroxy-[4-[(3-methylphenyl)methoxy]phenyl]methylidene]-5-pyridin-3-ylpyrrolidine-2,3-dione (PubChem CID 4698284) has the molecular formula C33H24Cl2N4O4S2 and a molecular weight of 675.62 g/mol. Its IUPAC name is 1-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-[hydroxy-[4-[(3-methylphenyl)methoxy]phenyl]methylidene]-5-pyridin-3-ylpyrrolidine-2,3-dione.
| Compound Name | 1-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-[hydroxy-[4-[(3-methylphenyl)methoxy]phenyl]methylidene]-5-pyridin-3-ylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 4698284 |
| Molecular Formula | C33H24Cl2N4O4S2 |
| Molecular Weight | 675.62 g/mol |
| Exact Mass | 674.06 |
| IUPAC Name | 1-[5-[(2,4-dichlorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-4-[hydroxy-[4-[(3-methylphenyl)methoxy]phenyl]methylidene]-5-pyridin-3-ylpyrrolidine-2,3-dione |
| SMILES | Cc1cccc(COc2ccc(C(O)=C3C(=O)C(=O)N(c4nnc(SCc5ccc(Cl)cc5Cl)s4)C3c3cccnc3)cc2)c1 |
| InChI | InChI=1S/C33H24Cl2N4O4S2/c1-19-4-2-5-20(14-19)17-43-25-11-8-21(9-12-25)29(40)27-28(22-6-3-13-36-16-22)39(31(42)30(27)41)32-37-38-33(45-32)44-18-23-7-10-24(34)15-26(23)35/h2-16,28,40H,17-18H2,1H3 |
| InChIKey | JFMZDGXQKZXQFQ-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 105.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.62 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|